Products 892674-22-5
CAS 892674-22-5 appears in our catalog under these names: 2,7-Dimethylquinoline-4-carboxylic acid, 95%, 2,7-Dimethylquinoline-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
2,7-dimethylquinoline-4-carboxylic acid (CAS 892674-22-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2,7-dimethylquinoline-4-carboxylic acid. InChIKey: ICCQYBHJLONXFL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2,7-dimethylquinoline-4-carboxylic acid |
| InChIKey | ICCQYBHJLONXFL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CC(=C2C=C1)C(=O)O)C |
Computed by PubChem (NCBI)