CAS 893-33-4 appears in our catalog under these names: 4,4,4–Trifluoro–1–(2–naphthyl)–1,3–butanedione, 4,4,4-Trifluoro-1-(2-naphthyl)-1,3-butanedione, 99% , 4,4,4-Trifluoro-1-(2-naphthyl)-1,3-butanedione, >98.0%(GC), 4,4,4-TRIFLUORO-1-(2-NAPHTHYL)-1,3- &, 4,4,4-Trifluoro-1-(naphthalen-2-yl)butane-1,3-dione, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-dione (CAS 893-33-4) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-dione. InChIKey: WVVLURYIQCXPIV-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-dione |
| InChIKey | WVVLURYIQCXPIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)