Products 894802-34-7
CAS 894802-34-7 appears in our catalog under these names: N-(3,4-Dichlorophenyl)piperidine-4-carboxamide, 95%, N-(3,4-Dichlorophenyl)piperidine-4-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N-(3,4-dichlorophenyl)piperidine-4-carboxamide (CAS 894802-34-7) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: N-(3,4-dichlorophenyl)piperidine-4-carboxamide. InChIKey: DQLZFLYOQQRZFX-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)piperidine-4-carboxamide |
| InChIKey | DQLZFLYOQQRZFX-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)