CAS 89521-54-0 appears in our catalog under these names: 2-Nitro-6-(phenylmethoxy)benzenamine, 2-(Benzyloxy)-6-nitroaniline 95+%. Offered by: TRC, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2-nitro-6-phenylmethoxyaniline (CAS 89521-54-0) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 2-nitro-6-phenylmethoxyaniline. InChIKey: SLTIDGKIYKFTSN-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2-nitro-6-phenylmethoxyaniline |
| InChIKey | SLTIDGKIYKFTSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2N)[N+](=O)[O-] |
Computed by PubChem (NCBI)