CAS 89555-39-5 appears in our catalog under these names: methyl 1–bromonaphthalene–2–carboxylate, 2-Naphthalenecarboxylic acid, 1-bromo-, methyl ester, Methyl 1-bromo-2-naphthoate 98%, 1-Bromonaphthalene-2-carboxylic acid methyl ester, 98%, 98%, Methyl 1-bromo-2-naphthoate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 250mg, 100mg.
Methyl 1-bromonaphthalene-2-carboxylate (CAS 89555-39-5) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: methyl 1-bromonaphthalene-2-carboxylate. InChIKey: DAUCSGSCDZOKLE-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | methyl 1-bromonaphthalene-2-carboxylate |
| InChIKey | DAUCSGSCDZOKLE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)