CAS 895766-35-5 appears in our catalog under these names: 3-(1,3-Dioxooctahydro-2H-isoindol-2-yl)-4-methylbenzoic acid, 98%, 3-(1,3-Dioxo-octahydro-1H-isoindol-2-yl)-4-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylbenzoic acid (CAS 895766-35-5) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylbenzoic acid. InChIKey: HFSSAWJPQSZVAL-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylbenzoic acid |
| InChIKey | HFSSAWJPQSZVAL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)N2C(=O)C3CCCCC3C2=O |
Computed by PubChem (NCBI)