CAS 89862-27-1 is the registry number for Ethyl 4-(hydrazinesulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-(hydrazinesulfonyl)benzoate (CAS 89862-27-1) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: ethyl 4-(hydrazinesulfonyl)benzoate. InChIKey: QHEKOEKOWFGCLH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | ethyl 4-(hydrazinesulfonyl)benzoate |
| InChIKey | QHEKOEKOWFGCLH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)S(=O)(=O)NN |
Computed by PubChem (NCBI)