CAS 898787-73-0 is the registry number for 3-(2,2,2-Trifluoroacetyl)phenyl acetate, 99%, 99%. Offered by: Chemat. Available pack sizes: 2g.
[3-(2,2,2-trifluoroacetyl)phenyl] acetate (CAS 898787-73-0) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: [3-(2,2,2-trifluoroacetyl)phenyl] acetate. InChIKey: IOQXUBKAIQXQSD-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | [3-(2,2,2-trifluoroacetyl)phenyl] acetate |
| InChIKey | IOQXUBKAIQXQSD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)