Products 89977-05-9

CAS 89977-05-9 is the registry number for 2-Amino-6-methylpyridine-3,4-dicarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-amino-6-methylpyridine-3,4-dicarboxylic acid (CAS 89977-05-9) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 2-amino-6-methylpyridine-3,4-dicarboxylic acid. InChIKey: WXPJNLPARRDKIN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O4
Molecular weight196.16 g/mol
IUPAC name2-amino-6-methylpyridine-3,4-dicarboxylic acid
InChIKeyWXPJNLPARRDKIN-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=N1)N)C(=O)O)C(=O)O

Computed by PubChem (NCBI)