CAS 89977-05-9 is the registry number for 2-Amino-6-methylpyridine-3,4-dicarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-6-methylpyridine-3,4-dicarboxylic acid (CAS 89977-05-9) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 2-amino-6-methylpyridine-3,4-dicarboxylic acid. InChIKey: WXPJNLPARRDKIN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-amino-6-methylpyridine-3,4-dicarboxylic acid |
| InChIKey | WXPJNLPARRDKIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)