Products 90050-64-9
CAS 90050-64-9 is the registry number for 3-bromo-4-(hydroxymethyl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-4-(hydroxymethyl)benzoic acid (CAS 90050-64-9) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-4-(hydroxymethyl)benzoic acid. InChIKey: DNVYNHKIISUSFF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-4-(hydroxymethyl)benzoic acid |
| InChIKey | DNVYNHKIISUSFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)CO |
Computed by PubChem (NCBI)