CAS 90058-29-0 is the registry number for Alaptide. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(8S)-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (CAS 90058-29-0) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: (8S)-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione. InChIKey: LTRSPDHUDXWHRY-LURJTMIESA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (8S)-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| InChIKey | LTRSPDHUDXWHRY-LURJTMIESA-N |
| SMILES | C[C@H]1C(=O)NC2(CCCC2)C(=O)N1 |
Computed by PubChem (NCBI)