CAS 90323-72-1 is the registry number for 3-Phenyl-1,2,4-oxadiazole-5-carbohydrazide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-phenyl-1,2,4-oxadiazole-5-carbohydrazide (CAS 90323-72-1) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 3-phenyl-1,2,4-oxadiazole-5-carbohydrazide. InChIKey: CUZXTYBNQLZUTH-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 3-phenyl-1,2,4-oxadiazole-5-carbohydrazide |
| InChIKey | CUZXTYBNQLZUTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C(=O)NN |
Computed by PubChem (NCBI)