CAS 90325-36-3 is the registry number for 5-Bromopyridine-3,4-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromopyridine-3,4-dicarboxylic acid (CAS 90325-36-3) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromopyridine-3,4-dicarboxylic acid. InChIKey: ODVOJWAGUGFOCF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromopyridine-3,4-dicarboxylic acid |
| InChIKey | ODVOJWAGUGFOCF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)