Products 90325-36-3

CAS 90325-36-3 is the registry number for 5-Bromopyridine-3,4-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromopyridine-3,4-dicarboxylic acid (CAS 90325-36-3) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromopyridine-3,4-dicarboxylic acid. InChIKey: ODVOJWAGUGFOCF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrNO4
Molecular weight246.01 g/mol
IUPAC name5-bromopyridine-3,4-dicarboxylic acid
InChIKeyODVOJWAGUGFOCF-UHFFFAOYSA-N
SMILESC1=C(C(=C(C=N1)Br)C(=O)O)C(=O)O

Computed by PubChem (NCBI)