CAS 903560-42-9 appears in our catalog under these names: Methyl 4-phenyl-1H-pyrrole-2-carboxylate, 95%, Methyl 4-phenyl-1H-pyrrole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-phenyl-1H-pyrrole-2-carboxylate (CAS 903560-42-9) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 4-phenyl-1H-pyrrole-2-carboxylate. InChIKey: HTDLNIQLELERCP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 4-phenyl-1H-pyrrole-2-carboxylate |
| InChIKey | HTDLNIQLELERCP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)