CAS 90417-44-0 is the registry number for N-(4-Methylthiazol-2-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-methyl-1,3-thiazol-2-yl)furan-2-carboxamide (CAS 90417-44-0) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: N-(4-methyl-1,3-thiazol-2-yl)furan-2-carboxamide. InChIKey: UMDJLYVJPFBLDQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | N-(4-methyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| InChIKey | UMDJLYVJPFBLDQ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)