CAS 90418-04-5 appears in our catalog under these names: 2-Cyano-n-(2,3-dichlorophenyl)acetamide, 95%, 2–Cyano–N–(2，3–dichlorophenyl)acetamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-cyano-N-(2,3-dichlorophenyl)acetamide (CAS 90418-04-5) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2-cyano-N-(2,3-dichlorophenyl)acetamide. InChIKey: PAARTMNKZUCFOT-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-cyano-N-(2,3-dichlorophenyl)acetamide |
| InChIKey | PAARTMNKZUCFOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NC(=O)CC#N |
Computed by PubChem (NCBI)