Products 90418-21-6
CAS 90418-21-6 is the registry number for 3–(3，5–Dichlorophenyl)acrylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
(E)-3-(3,5-dichlorophenyl)prop-2-enoic acid (CAS 90418-21-6) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(3,5-dichlorophenyl)prop-2-enoic acid. InChIKey: HJKSYRZNDJQTJQ-OWOJBTEDSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(3,5-dichlorophenyl)prop-2-enoic acid |
| InChIKey | HJKSYRZNDJQTJQ-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3,5-dichlorophenyl)acrylic acid, (E)-3-(3,5-Dichlorophenyl)acrylic acid, (2E)-3-(3,5-Dichlorophenyl)acrylic acid, (E)-3-(3,5-dichlorophenyl)prop-2-enoic Acid, (2E)-3-(3,5-dichlorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(3,5-dichlorophenyl)-, (2E)-, trans-3,5-Dichlorocinnamic acid, (E)-3-(3,5-Dichlorophenyl)acrylicacid, 2-Propenoic acid, 3-(3,5-dichlorophenyl)-, (E)-3-(3,5-Dichlorophenyl)propenoic acid