Products 904643-35-2
CAS 904643-35-2 appears in our catalog under these names: 4-(5-(Trifluoromethyl)-1,3,4-oxadiazol-2-yl)aniline, 98%, 4-(5-(Trifluoromethyl)-1,3,4-oxadiazol-2-yl)aniline, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 904643-35-2) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: PXWKJTLVIBEGDQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | PXWKJTLVIBEGDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C(F)(F)F)N |
Computed by PubChem (NCBI)