Products 904671-24-5
CAS 904671-24-5 is the registry number for Tazobactam Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S,5R)-3-methyl-4,7-dioxo-3-(triazol-1-ylmethyl)-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 904671-24-5) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: (2S,3S,5R)-3-methyl-4,7-dioxo-3-(triazol-1-ylmethyl)-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: ISBRSVBGQNSBLY-PFQOTVATSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (2S,3S,5R)-3-methyl-4,7-dioxo-3-(triazol-1-ylmethyl)-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | ISBRSVBGQNSBLY-PFQOTVATSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1=O)CC2=O)C(=O)O)CN3C=CN=N3 |
Computed by PubChem (NCBI)