Products 349463-45-2
CAS 349463-45-2 is the registry number for amino((1-aza-2-(4,5-dimethoxy-2-nitrophenyl)vinyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
[(4,5-dimethoxy-2-nitrophenyl)methylideneamino]thiourea (CAS 349463-45-2) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: [(4,5-dimethoxy-2-nitrophenyl)methylideneamino]thiourea. InChIKey: YQHFMQFTTFVZBA-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | [(4,5-dimethoxy-2-nitrophenyl)methylideneamino]thiourea |
| InChIKey | YQHFMQFTTFVZBA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=NNC(=S)N)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)