Products 82331-13-3
CAS 82331-13-3 is the registry number for 2-((1,3-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]propanoic acid (CAS 82331-13-3) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]propanoic acid. InChIKey: VPVDJDHIFPLZGA-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]propanoic acid |
| InChIKey | VPVDJDHIFPLZGA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC1=NC2=C(N1)C(=O)N(C(=O)N2C)C |
Computed by PubChem (NCBI)