Products 58004-19-6
CAS 58004-19-6 is the registry number for 4’-Thioinosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one (CAS 58004-19-6) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: 9-[3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one. InChIKey: HJYJLNGDBFAKPJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 9-[3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one |
| InChIKey | HJYJLNGDBFAKPJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(S3)CO)O)O |
Computed by PubChem (NCBI)