CAS 574-25-4 appears in our catalog under these names: 6-Mercaptopurine riboside, 95%, 6-Mercaptopurine-9-b-D-ribofuranoside (~90%), 6-Mercaptopurine-9-beta-D-ribofuranoside (~90%), 6-Thioinosine/ 100%, 6-Thioinosine. Offered by: Combi-blocks, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 2,5g, 2mg, 5mg, 10mg, 25mg.
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione (CAS 574-25-4) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione. InChIKey: NKGPJODWTZCHGF-KQYNXXCUSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
| InChIKey | NKGPJODWTZCHGF-KQYNXXCUSA-N |
| SMILES | C1=NC(=S)C2=C(N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)