Products 1215522-54-5
CAS 1215522-54-5 is the registry number for 2–Azido–1–(4’–methoxy–3’–sulfonamidophenyl)–1–propanone–d3. Offered by: GLPBio. Available pack sizes: 100mg.
5-(2-azido-3,3,3-trideuteriopropanoyl)-2-methoxybenzenesulfonamide (CAS 1215522-54-5) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 287.31 g/mol. IUPAC name: 5-(2-azido-3,3,3-trideuteriopropanoyl)-2-methoxybenzenesulfonamide. InChIKey: ICHKWKOXWTUWKF-FIBGUPNXSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 5-(2-azido-3,3,3-trideuteriopropanoyl)-2-methoxybenzenesulfonamide |
| InChIKey | ICHKWKOXWTUWKF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)C1=CC(=C(C=C1)OC)S(=O)(=O)N)N=[N+]=[N-] |
Computed by PubChem (NCBI)