CAS 90899-89-1 is the registry number for 6-Mercaptopurine arabinoside, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione (CAS 90899-89-1) is a chemical compound with the molecular formula C10H12N4O4S and a molecular weight of 284.29 g/mol. IUPAC name: 9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione. InChIKey: NKGPJODWTZCHGF-UHTZMRCNSA-N.
| Molecular formula | C10H12N4O4S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
| InChIKey | NKGPJODWTZCHGF-UHTZMRCNSA-N |
| SMILES | C1=NC(=S)C2=C(N1)N(C=N2)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)