Products 90481-47-3
CAS 90481-47-3 appears in our catalog under these names: 2-(Benzo[d]thiazol-2-yl)-4,6-dimethylphenol, 95%, 2-(2-Benzothiazolyl)-4,6-dimethylphenol, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(1,3-benzothiazol-2-yl)-4,6-dimethylphenol (CAS 90481-47-3) is a chemical compound with the molecular formula C15H13NOS and a molecular weight of 255.3 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4,6-dimethylphenol. InChIKey: QIXCLLLELVPXQT-UHFFFAOYSA-N.
| Molecular formula | C15H13NOS |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4,6-dimethylphenol |
| InChIKey | QIXCLLLELVPXQT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C2=NC3=CC=CC=C3S2)O)C |
Computed by PubChem (NCBI)