CAS 90508-28-4 appears in our catalog under these names: (S)-2-(((Allyloxy)carbonyl)amino)propanoic acid, 95%, Aloc–Ala–OH · DCHA, Aloc-Ala-OH·DCHA, Alloc-Ala-OH 97%, Aloc-Ala-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 2g, 100mg.
(2S)-2-(prop-2-enoxycarbonylamino)propanoic acid (CAS 90508-28-4) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S)-2-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: YLYYGPXCIWHLPP-YFKPBYRVSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (2S)-2-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | YLYYGPXCIWHLPP-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)