Products 90537-39-6

CAS 90537-39-6 is the registry number for Ethyl 3-chloro-4-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-chloro-4-nitrobenzoate (CAS 90537-39-6) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: ethyl 3-chloro-4-nitrobenzoate. InChIKey: PKKLIUDCVJOQJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO4
Molecular weight229.62 g/mol
IUPAC nameethyl 3-chloro-4-nitrobenzoate
InChIKeyPKKLIUDCVJOQJQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)