CAS 90537-39-6 is the registry number for Ethyl 3-chloro-4-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-chloro-4-nitrobenzoate (CAS 90537-39-6) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: ethyl 3-chloro-4-nitrobenzoate. InChIKey: PKKLIUDCVJOQJQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | ethyl 3-chloro-4-nitrobenzoate |
| InChIKey | PKKLIUDCVJOQJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)