Products 90734-55-7
CAS 90734-55-7 appears in our catalog under these names: 4-tert-Butylphenoxyacetyl chloride, 98% , 2-(4-(tert-Butyl)phenoxy)acetyl chloride 98%, (4-tert-butylphenoxy)acetyl chloride, 98%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 10g, 50g, 250g, 250mg, 1g, 5g, 25g, 100g.
2-(4-tert-butylphenoxy)acetyl chloride (CAS 90734-55-7) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 2-(4-tert-butylphenoxy)acetyl chloride. InChIKey: CFTNMBDQWVPSHI-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 2-(4-tert-butylphenoxy)acetyl chloride |
| InChIKey | CFTNMBDQWVPSHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butylphenoxyacetyl chloride, 2-(4-tert-butylphenoxy)acetyl chloride, (4-tert-Butylphenoxy)acetyl chloride, 4-tert-Butylphenoxyacetyl cloride, 2-(4-(tert-Butyl)phenoxy)acetyl chloride, 2-[4-(tert-butyl)phenoxy]acetyl chloride, Acetyl chloride, [4-(1,1-dimethylethyl)phenoxy]-, [4-(1,1-Dimethylethyl)phenoxy]acetyl chloride, para-t-butylphenoxyacetyl chloride, (p-t-Butylphenoxy)acetyl Chloride