Products 908069-17-0
CAS 908069-17-0 is the registry number for NSC 698600. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg.
2-(4-methoxyphenyl)-5-methyl-[1,2]thiazolo[5,4-b]pyridin-3-one (CAS 908069-17-0) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-methyl-[1,2]thiazolo[5,4-b]pyridin-3-one. InChIKey: JWDLSSYXAGGQHA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-methyl-[1,2]thiazolo[5,4-b]pyridin-3-one |
| InChIKey | JWDLSSYXAGGQHA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)SN(C2=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)