CAS 909389-74-8 appears in our catalog under these names: 3,5-Dibromophenyl acetate, 98%, 3,5-Dibromophenyl acetate 97%, 3,5-Dibromophenyl acetate, 97%, 97%, 3,5-DIBROMOPHENYL ACETATE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
(3,5-dibromophenyl) acetate (CAS 909389-74-8) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: (3,5-dibromophenyl) acetate. InChIKey: QPXGHGNAEBFULS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | (3,5-dibromophenyl) acetate |
| InChIKey | QPXGHGNAEBFULS-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)