CAS 90942-47-5 appears in our catalog under these names: methyl 5-(aminomethyl)-2-chlorobenzoate hydrochloride, Methyl 5-(aminomethyl)-2-chlorobenzoate hydrochloride, 96%, Methyl 5-(aminomethyl)-2-chlorobenzoate hydrochloride, 97%, Benzoic acid, 5-(aminomethyl)-2-chloro-, methyl ester, hydrochloride (1:1), 96%, 96%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 100mg.
Methyl 5-(aminomethyl)-2-chlorobenzoate;hydrochloride (CAS 90942-47-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-chlorobenzoate;hydrochloride. InChIKey: RVCZOTOWWCOGCQ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-chlorobenzoate;hydrochloride |
| InChIKey | RVCZOTOWWCOGCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CN)Cl.Cl |
Computed by PubChem (NCBI)