CAS 910036-92-9 appears in our catalog under these names: 3-Pyrimidin-2-ylbenzylamine, 95% , (3-(Pyrimidin-2-yl)phenyl)methanamine 97%. Offered by: Thermo Scientific, Ambeed. Available pack sizes: 250MG, 1g, 100mg.
(3-pyrimidin-2-ylphenyl)methanamine (CAS 910036-92-9) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: (3-pyrimidin-2-ylphenyl)methanamine. InChIKey: MXSXDKVANPZCBQ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (3-pyrimidin-2-ylphenyl)methanamine |
| InChIKey | MXSXDKVANPZCBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CC=N2)CN |
Computed by PubChem (NCBI)