CAS 910441-34-8 is the registry number for [1,2'-Binaphthalen]-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-naphthalen-2-ylnaphthalen-2-amine (CAS 910441-34-8) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 1-naphthalen-2-ylnaphthalen-2-amine. InChIKey: DUILWVYHNORFID-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 1-naphthalen-2-ylnaphthalen-2-amine |
| InChIKey | DUILWVYHNORFID-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C(C=CC4=CC=CC=C43)N |
Computed by PubChem (NCBI)