CAS 47135-83-1 is the registry number for 6-p-Tolyl-phenanthridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-(4-methylphenyl)phenanthridine (CAS 47135-83-1) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 6-(4-methylphenyl)phenanthridine. InChIKey: XIRNJVPACPYZIY-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 6-(4-methylphenyl)phenanthridine |
| InChIKey | XIRNJVPACPYZIY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)