CAS 14181-84-1 appears in our catalog under these names: N-(Diphenylethenylidene)aniline, 95%, N-(Diphenylethenylidene)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N,2,2-triphenylethenimine (CAS 14181-84-1) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: N,2,2-triphenylethenimine. InChIKey: VQOIZBIQANZRDY-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | N,2,2-triphenylethenimine |
| InChIKey | VQOIZBIQANZRDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C=NC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)