Products 910467-92-4
CAS 910467-92-4 appears in our catalog under these names: 4-((4-Aminophenyl)ethynyl)benzoic acid, 95%, 4-((4-Aminophenyl)ethynyl)benzoic acid, 97%, 4-((4-AMINOPHENYL)ETHYNYL)BENZOIC ACID, 98%, 4-((4-Aminophenyl)Ethynyl)Benzoic Acid, 95%+, 4-((4-Aminophenyl)ethynyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg.
4-[2-(4-aminophenyl)ethynyl]benzoic acid (CAS 910467-92-4) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 4-[2-(4-aminophenyl)ethynyl]benzoic acid. InChIKey: XETDUQSABYXZNK-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)ethynyl]benzoic acid |
| InChIKey | XETDUQSABYXZNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)