CAS 91064-04-9 is the registry number for 3-Chloro-7-hydroxy-4,8-dimethyl-2H-1-benzopyran-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-7-hydroxy-4,8-dimethylchromen-2-one (CAS 91064-04-9) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 3-chloro-7-hydroxy-4,8-dimethylchromen-2-one. InChIKey: ANWOOWDBJVPAHR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-chloro-7-hydroxy-4,8-dimethylchromen-2-one |
| InChIKey | ANWOOWDBJVPAHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2C)O)Cl |
Computed by PubChem (NCBI)