Products 911132-56-4
CAS 911132-56-4 is the registry number for methyl 2,3,4,6-tetradeuterio-5-nitro-benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2,3,4,6-tetradeuterio-5-nitrobenzoate (CAS 911132-56-4) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 185.17 g/mol. IUPAC name: methyl 2,3,4,6-tetradeuterio-5-nitrobenzoate. InChIKey: AXLYJLKKPUICKV-QFFDRWTDSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | methyl 2,3,4,6-tetradeuterio-5-nitrobenzoate |
| InChIKey | AXLYJLKKPUICKV-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])C(=O)OC)[2H] |
Computed by PubChem (NCBI)