Products 911137-05-8
CAS 911137-05-8 is the registry number for (R)-2-(1,3-Dioxoisoindolin-2-yl)-3,3-dimethylbutanoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethylbutanoic acid (CAS 911137-05-8) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethylbutanoic acid. InChIKey: RZEIABQUGXEDJK-JTQLQIEISA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3,3-dimethylbutanoic acid |
| InChIKey | RZEIABQUGXEDJK-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)