CAS 91142-58-4 appears in our catalog under these names: 2-Methyl-2,3-dihydro-1H-indene-2-carboxylic acid, 97%, 2-Methyl-indan-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 50mg, 0,5g.
2-methyl-1,3-dihydroindene-2-carboxylic acid (CAS 91142-58-4) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-methyl-1,3-dihydroindene-2-carboxylic acid. InChIKey: VWCCBMWZNOWFDT-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-methyl-1,3-dihydroindene-2-carboxylic acid |
| InChIKey | VWCCBMWZNOWFDT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC=CC=C2C1)C(=O)O |
Computed by PubChem (NCBI)