CAS 912761-28-5 is the registry number for (2-Phenyl-2h-1,2,3-triazol-4-yl)methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-phenyltriazol-4-yl)methanamine (CAS 912761-28-5) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: (2-phenyltriazol-4-yl)methanamine. InChIKey: WDTYDDGWHKTJJD-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-phenyltriazol-4-yl)methanamine |
| InChIKey | WDTYDDGWHKTJJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=CC(=N2)CN |
Computed by PubChem (NCBI)