CAS 91361-07-8 appears in our catalog under these names: (1S,2S)-N1,N1,N2,N2-Tetramethyl-1,2-diphenylethane-1,2-diamine, 97%, 97%, (1S,2S)-N1,N1,N2,N2-Tetramethyl-1,2-diphenylethane-1,2-diamine, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(1S,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-diamine (CAS 91361-07-8) is a chemical compound with the molecular formula C18H24N2 and a molecular weight of 268.4 g/mol. IUPAC name: (1S,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-diamine. InChIKey: MYLJZKKJRGGLPH-ROUUACIJSA-N.
| Molecular formula | C18H24N2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | (1S,2S)-N,N,N',N'-tetramethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | MYLJZKKJRGGLPH-ROUUACIJSA-N |
| SMILES | CN(C)[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)N(C)C |
Computed by PubChem (NCBI)