CAS 91420-41-6 is the registry number for 1-(1-Benzofuran-2-yl)-2-methylpropan-1-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(1-benzofuran-2-yl)-2-methylpropan-1-one (CAS 91420-41-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 1-(1-benzofuran-2-yl)-2-methylpropan-1-one. InChIKey: IGAIWEBMXRYARK-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 1-(1-benzofuran-2-yl)-2-methylpropan-1-one |
| InChIKey | IGAIWEBMXRYARK-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)