CAS 914207-85-5 appears in our catalog under these names: Nebivolol Impurity 43, 6-Fluoro-4-hydroxy-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
6-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 914207-85-5) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: 6-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: KXOVSLMYWYSTAR-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 6-fluoro-4-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | KXOVSLMYWYSTAR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C=CC(=C2)F)OC1C(=O)O)O |
Computed by PubChem (NCBI)