CAS 91426-39-0 is the registry number for 5-(3'-Hydroxybenzylidene)hydantoin. Offered by: TRC. Available pack sizes: 10g, 1g.
(5E)-5-[(3-hydroxyphenyl)methylidene]imidazolidine-2,4-dione (CAS 91426-39-0) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: (5E)-5-[(3-hydroxyphenyl)methylidene]imidazolidine-2,4-dione. InChIKey: HZAHUPKFCIYWHZ-VMPITWQZSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (5E)-5-[(3-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
| InChIKey | HZAHUPKFCIYWHZ-VMPITWQZSA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=C/2\C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)