CAS 915394-87-5 is the registry number for 3-(2,4-Dichlorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-dichlorophenyl)-2-oxopropanoic acid (CAS 915394-87-5) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-2-oxopropanoic acid. InChIKey: ZATJDJXSYJQFEO-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-2-oxopropanoic acid |
| InChIKey | ZATJDJXSYJQFEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)C(=O)O |
Computed by PubChem (NCBI)