Products 2390-40-1

CAS 2390-40-1 is the registry number for 2-Methoxyisophthaloyl dichloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-methoxybenzene-1,3-dicarbonyl chloride (CAS 2390-40-1) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: 2-methoxybenzene-1,3-dicarbonyl chloride. InChIKey: VFUGSYTXEHFZSI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O3
Molecular weight233.04 g/mol
IUPAC name2-methoxybenzene-1,3-dicarbonyl chloride
InChIKeyVFUGSYTXEHFZSI-UHFFFAOYSA-N
SMILESCOC1=C(C=CC=C1C(=O)Cl)C(=O)Cl

Computed by PubChem (NCBI)