CAS 2390-40-1 is the registry number for 2-Methoxyisophthaloyl dichloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxybenzene-1,3-dicarbonyl chloride (CAS 2390-40-1) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: 2-methoxybenzene-1,3-dicarbonyl chloride. InChIKey: VFUGSYTXEHFZSI-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 2-methoxybenzene-1,3-dicarbonyl chloride |
| InChIKey | VFUGSYTXEHFZSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)