CAS 1379297-25-2 is the registry number for Methyl 3,5-dichloro-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-(3,5-dichlorophenyl)-2-oxoacetate (CAS 1379297-25-2) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: methyl 2-(3,5-dichlorophenyl)-2-oxoacetate. InChIKey: WJTARTFNVWLIQU-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3 |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | methyl 2-(3,5-dichlorophenyl)-2-oxoacetate |
| InChIKey | WJTARTFNVWLIQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)