Products 92948-50-0

CAS 92948-50-0 is the registry number for 3-(3,5-Dichlorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,5-dichlorophenyl)-2-oxopropanoic acid (CAS 92948-50-0) is a chemical compound with the molecular formula C9H6Cl2O3 and a molecular weight of 233.04 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-2-oxopropanoic acid. InChIKey: AIWZBFDXFOBWOM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2O3
Molecular weight233.04 g/mol
IUPAC name3-(3,5-dichlorophenyl)-2-oxopropanoic acid
InChIKeyAIWZBFDXFOBWOM-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)CC(=O)C(=O)O

Computed by PubChem (NCBI)